C13H14N2O4S2 — CID 17470879
N-ethoxy-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 17470879) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-ethoxy-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-ethoxy-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 17470879 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-ethoxy-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CCONC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C13H14N2O4S2/c1-2-19-14-13(16)10-5-7-11(8-6-10)15-21(17,18)12-4-3-9-20-12/h3-9,15H,2H2,1H3,(H,14,16) |
| InChIKey | BJDWOHSFLPXBKD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|