C14H16N2O4S2 — CID 60597755
N-ethoxy-4-(thiophen-2-ylmethylsulfamoyl)benzamide (PubChem CID 60597755) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-ethoxy-4-(thiophen-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-ethoxy-4-(thiophen-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 60597755 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | N-ethoxy-4-(thiophen-2-ylmethylsulfamoyl)benzamide |
| SMILES | CCONC(=O)c1ccc(S(=O)(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-2-20-16-14(17)11-5-7-13(8-6-11)22(18,19)15-10-12-4-3-9-21-12/h3-9,15H,2,10H2,1H3,(H,16,17) |
| InChIKey | MGPKJNXHXPORMZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|