C13H16N2O4S2 — CID 22515786
ethyl 1-methyl-4-(thiophen-2-ylmethylsulfamoyl)pyrrole-2-carboxylate (PubChem CID 22515786) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is ethyl 1-methyl-4-(thiophen-2-ylmethylsulfamoyl)pyrrole-2-carboxylate.
| Compound Name | ethyl 1-methyl-4-(thiophen-2-ylmethylsulfamoyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 22515786 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | ethyl 1-methyl-4-(thiophen-2-ylmethylsulfamoyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)NCc2cccs2)cn1C |
| InChI | InChI=1S/C13H16N2O4S2/c1-3-19-13(16)12-7-11(9-15(12)2)21(17,18)14-8-10-5-4-6-20-10/h4-7,9,14H,3,8H2,1-2H3 |
| InChIKey | ARVZVCCLDSBSSP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |