C15H15F3N2O5S — CID 46271592
ethyl 1-methyl-4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]pyrrole-2-carboxylate (PubChem CID 46271592) has the molecular formula C15H15F3N2O5S and a molecular weight of 392.36 g/mol. Its IUPAC name is ethyl 1-methyl-4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-methyl-4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46271592 |
| Molecular Formula | C15H15F3N2O5S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | ethyl 1-methyl-4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)Nc2ccc(OC(F)(F)F)cc2)cn1C |
| InChI | InChI=1S/C15H15F3N2O5S/c1-3-24-14(21)13-8-12(9-20(13)2)26(22,23)19-10-4-6-11(7-5-10)25-15(16,17)18/h4-9,19H,3H2,1-2H3 |
| InChIKey | NIWRYZKICLHBSS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |