C17H17F3N2O4 — CID 90292042
ethyl 1-methyl-4-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]pyrrole-2-carboxylate (PubChem CID 90292042) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is ethyl 1-methyl-4-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-methyl-4-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 90292042 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | ethyl 1-methyl-4-[[2-[4-(trifluoromethoxy)phenyl]acetyl]amino]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)Cc2ccc(OC(F)(F)F)cc2)cn1C |
| InChI | InChI=1S/C17H17F3N2O4/c1-3-25-16(24)14-9-12(10-22(14)2)21-15(23)8-11-4-6-13(7-5-11)26-17(18,19)20/h4-7,9-10H,3,8H2,1-2H3,(H,21,23) |
| InChIKey | XHPQNZDNXFSLEJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |