C12H10F3N3O2 — CID 60506630
N-(1H-pyrazol-4-yl)-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 60506630) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.23 g/mol. Its IUPAC name is N-(1H-pyrazol-4-yl)-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-(1H-pyrazol-4-yl)-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 60506630 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-(1H-pyrazol-4-yl)-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C12H10F3N3O2/c13-12(14,15)20-10-3-1-8(2-4-10)5-11(19)18-9-6-16-17-7-9/h1-4,6-7H,5H2,(H,16,17)(H,18,19) |
| InChIKey | PNHZKKPJVJSDLV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |