C12H18ClN3O3 — CID 119817091
ethyl 4-[(1-aminocyclopropanecarbonyl)amino]-1-methylpyrrole-2-carboxylate;hydrochloride (PubChem CID 119817091) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is ethyl 4-[(1-aminocyclopropanecarbonyl)amino]-1-methylpyrrole-2-carboxylate;hydrochloride.
| Compound Name | ethyl 4-[(1-aminocyclopropanecarbonyl)amino]-1-methylpyrrole-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119817091 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | ethyl 4-[(1-aminocyclopropanecarbonyl)amino]-1-methylpyrrole-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cc(NC(=O)C2(N)CC2)cn1C.Cl |
| InChI | InChI=1S/C12H17N3O3.ClH/c1-3-18-10(16)9-6-8(7-15(9)2)14-11(17)12(13)4-5-12;/h6-7H,3-5,13H2,1-2H3,(H,14,17);1H |
| InChIKey | OBYZGCOVCWHCHD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |