C14H21N3O4 — CID 120921441
methyl 4-[[4-(aminomethyl)oxane-4-carbonyl]amino]-1-methylpyrrole-2-carboxylate (PubChem CID 120921441) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 4-[[4-(aminomethyl)oxane-4-carbonyl]amino]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[[4-(aminomethyl)oxane-4-carbonyl]amino]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 120921441 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | methyl 4-[[4-(aminomethyl)oxane-4-carbonyl]amino]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C2(CN)CCOCC2)cn1C |
| InChI | InChI=1S/C14H21N3O4/c1-17-8-10(7-11(17)12(18)20-2)16-13(19)14(9-15)3-5-21-6-4-14/h7-8H,3-6,9,15H2,1-2H3,(H,16,19) |
| InChIKey | FNQZKLJBRNNVQD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |