C15H21BrN2O2 — CID 107574152
4-(aminomethyl)-N-(4-bromo-3,5-dimethylphenyl)oxane-4-carboxamide (PubChem CID 107574152) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(4-bromo-3,5-dimethylphenyl)oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-(4-bromo-3,5-dimethylphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 107574152 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-(aminomethyl)-N-(4-bromo-3,5-dimethylphenyl)oxane-4-carboxamide |
| SMILES | Cc1cc(NC(=O)C2(CN)CCOCC2)cc(C)c1Br |
| InChI | InChI=1S/C15H21BrN2O2/c1-10-7-12(8-11(2)13(10)16)18-14(19)15(9-17)3-5-20-6-4-15/h7-8H,3-6,9,17H2,1-2H3,(H,18,19) |
| InChIKey | MOLPIMXBVHLACO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |