C14H21N3O4S — CID 120919382
4-(aminomethyl)-N-(4-methyl-3-sulfamoylphenyl)oxane-4-carboxamide (PubChem CID 120919382) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(4-methyl-3-sulfamoylphenyl)oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-(4-methyl-3-sulfamoylphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 120919382 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-(aminomethyl)-N-(4-methyl-3-sulfamoylphenyl)oxane-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(CN)CCOCC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H21N3O4S/c1-10-2-3-11(8-12(10)22(16,19)20)17-13(18)14(9-15)4-6-21-7-5-14/h2-3,8H,4-7,9,15H2,1H3,(H,17,18)(H2,16,19,20) |
| InChIKey | RTAMJANMHUPDMT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |