C17H26FN3O4S — CID 120934525
4-(aminomethyl)-N-[3-(tert-butylsulfamoyl)-4-fluorophenyl]oxane-4-carboxamide (PubChem CID 120934525) has the molecular formula C17H26FN3O4S and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-(tert-butylsulfamoyl)-4-fluorophenyl]oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[3-(tert-butylsulfamoyl)-4-fluorophenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 120934525 |
| Molecular Formula | C17H26FN3O4S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-(aminomethyl)-N-[3-(tert-butylsulfamoyl)-4-fluorophenyl]oxane-4-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(NC(=O)C2(CN)CCOCC2)ccc1F |
| InChI | InChI=1S/C17H26FN3O4S/c1-16(2,3)21-26(23,24)14-10-12(4-5-13(14)18)20-15(22)17(11-19)6-8-25-9-7-17/h4-5,10,21H,6-9,11,19H2,1-3H3,(H,20,22) |
| InChIKey | OGLIFOFPMRWKMP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |