C16H25N3O5S — CID 120926434
4-(aminomethyl)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]oxane-4-carboxamide (PubChem CID 120926434) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]oxane-4-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 120926434 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-(aminomethyl)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]oxane-4-carboxamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)C2(CN)CCOCC2)cc1OC |
| InChI | InChI=1S/C16H25N3O5S/c1-3-25(21,22)19-13-5-4-12(10-14(13)23-2)18-15(20)16(11-17)6-8-24-9-7-16/h4-5,10,19H,3,6-9,11,17H2,1-2H3,(H,18,20) |
| InChIKey | UQIQAJBKZBCPND-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |