C14H22ClN3O3S — CID 119940391
ethyl 1-methyl-4-[(2-thiomorpholin-3-ylacetyl)amino]pyrrole-2-carboxylate;hydrochloride (PubChem CID 119940391) has the molecular formula C14H22ClN3O3S and a molecular weight of 347.87 g/mol. Its IUPAC name is ethyl 1-methyl-4-[(2-thiomorpholin-3-ylacetyl)amino]pyrrole-2-carboxylate;hydrochloride.
| Compound Name | ethyl 1-methyl-4-[(2-thiomorpholin-3-ylacetyl)amino]pyrrole-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119940391 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | ethyl 1-methyl-4-[(2-thiomorpholin-3-ylacetyl)amino]pyrrole-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cc(NC(=O)CC2CSCCN2)cn1C.Cl |
| InChI | InChI=1S/C14H21N3O3S.ClH/c1-3-20-14(19)12-6-10(8-17(12)2)16-13(18)7-11-9-21-5-4-15-11;/h6,8,11,15H,3-5,7,9H2,1-2H3,(H,16,18);1H |
| InChIKey | ZKLYYSVMQGIUJC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |