C13H20ClN3O3S2 — CID 119935518
N-(4-methyl-3-sulfamoylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119935518) has the molecular formula C13H20ClN3O3S2 and a molecular weight of 365.91 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119935518 |
| Molecular Formula | C13H20ClN3O3S2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)CC2CSCCN2)cc1S(N)(=O)=O.Cl |
| InChI | InChI=1S/C13H19N3O3S2.ClH/c1-9-2-3-10(6-12(9)21(14,18)19)16-13(17)7-11-8-20-5-4-15-11;/h2-3,6,11,15H,4-5,7-8H2,1H3,(H,16,17)(H2,14,18,19);1H |
| InChIKey | REAOQXRVVGVYID-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |