C14H21N3O3S2 — CID 119936303
N-[3-(methanesulfonamido)-4-methylphenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119936303) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)-4-methylphenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[3-(methanesulfonamido)-4-methylphenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119936303 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[3-(methanesulfonamido)-4-methylphenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | Cc1ccc(NC(=O)CC2CSCCN2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C14H21N3O3S2/c1-10-3-4-11(7-13(10)17-22(2,19)20)16-14(18)8-12-9-21-6-5-15-12/h3-4,7,12,15,17H,5-6,8-9H2,1-2H3,(H,16,18) |
| InChIKey | VRWKIUOJLOISOG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |