C12H14BrFN2OS — CID 115746725
N-(3-bromo-4-fluorophenyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 115746725) has the molecular formula C12H14BrFN2OS and a molecular weight of 333.23 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 115746725 |
| Molecular Formula | C12H14BrFN2OS |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H14BrFN2OS/c13-10-5-8(1-2-11(10)14)16-12(17)6-9-7-18-4-3-15-9/h1-2,5,9,15H,3-4,6-7H2,(H,16,17) |
| InChIKey | ZVMRNKKXCZFXPE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |