C12H14BrIN2OS — CID 114259879
N-(2-bromo-5-iodophenyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 114259879) has the molecular formula C12H14BrIN2OS and a molecular weight of 441.13 g/mol. Its IUPAC name is N-(2-bromo-5-iodophenyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(2-bromo-5-iodophenyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 114259879 |
| Molecular Formula | C12H14BrIN2OS |
| Molecular Weight | 441.13 g/mol |
| Exact Mass | 439.91 |
| IUPAC Name | N-(2-bromo-5-iodophenyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nc1cc(I)ccc1Br |
| InChI | InChI=1S/C12H14BrIN2OS/c13-10-2-1-8(14)5-11(10)16-12(17)6-9-7-18-4-3-15-9/h1-2,5,9,15H,3-4,6-7H2,(H,16,17) |
| InChIKey | JSMWPIKZCBAJJY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|