C11H16BrCl2N3O2S — CID 119941546
N-(5-bromo-2-oxo-1H-pyridin-3-yl)-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941546) has the molecular formula C11H16BrCl2N3O2S and a molecular weight of 405.15 g/mol. Its IUPAC name is N-(5-bromo-2-oxo-1H-pyridin-3-yl)-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-(5-bromo-2-oxo-1H-pyridin-3-yl)-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941546 |
| Molecular Formula | C11H16BrCl2N3O2S |
| Molecular Weight | 405.15 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | N-(5-bromo-2-oxo-1H-pyridin-3-yl)-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CSCCN1)Nc1cc(Br)c[nH]c1=O |
| InChI | InChI=1S/C11H14BrN3O2S.2ClH/c12-7-3-9(11(17)14-5-7)15-10(16)4-8-6-18-2-1-13-8;;/h3,5,8,13H,1-2,4,6H2,(H,14,17)(H,15,16);2*1H |
| InChIKey | PPPOMHNECNBWQZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |