C14H23Cl2N3OS — CID 119941042
N-[2-(dimethylamino)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941042) has the molecular formula C14H23Cl2N3OS and a molecular weight of 352.33 g/mol. Its IUPAC name is N-[2-(dimethylamino)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-[2-(dimethylamino)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941042 |
| Molecular Formula | C14H23Cl2N3OS |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[2-(dimethylamino)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | CN(C)c1ccccc1NC(=O)CC1CSCCN1.Cl.Cl |
| InChI | InChI=1S/C14H21N3OS.2ClH/c1-17(2)13-6-4-3-5-12(13)16-14(18)9-11-10-19-8-7-15-11;;/h3-6,11,15H,7-10H2,1-2H3,(H,16,18);2*1H |
| InChIKey | VVQFRIQLHGWZKH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |