C17H24N4O2S — CID 119937230
N-[2-[(2-thiomorpholin-3-ylacetyl)amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 119937230) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[2-[(2-thiomorpholin-3-ylacetyl)amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[(2-thiomorpholin-3-ylacetyl)amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 119937230 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[2-[(2-thiomorpholin-3-ylacetyl)amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(CC1CSCCN1)Nc1ccccc1NC(=O)N1CCCC1 |
| InChI | InChI=1S/C17H24N4O2S/c22-16(11-13-12-24-10-7-18-13)19-14-5-1-2-6-15(14)20-17(23)21-8-3-4-9-21/h1-2,5-6,13,18H,3-4,7-12H2,(H,19,22)(H,20,23) |
| InChIKey | QUGJPNIUKUNAIO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |