C17H25ClN2OS2 — CID 119936955
N-(2-cyclopentylsulfanylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119936955) has the molecular formula C17H25ClN2OS2 and a molecular weight of 372.99 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119936955 |
| Molecular Formula | C17H25ClN2OS2 |
| Molecular Weight | 372.99 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)Nc1ccccc1SC1CCCC1 |
| InChI | InChI=1S/C17H24N2OS2.ClH/c20-17(11-13-12-21-10-9-18-13)19-15-7-3-4-8-16(15)22-14-5-1-2-6-14;/h3-4,7-8,13-14,18H,1-2,5-6,9-12H2,(H,19,20);1H |
| InChIKey | HZHREILXCDXOAP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.99 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |