C13H16ClF3N2OS2 — CID 119936148
2-thiomorpholin-3-yl-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide;hydrochloride (PubChem CID 119936148) has the molecular formula C13H16ClF3N2OS2 and a molecular weight of 372.87 g/mol. Its IUPAC name is 2-thiomorpholin-3-yl-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-thiomorpholin-3-yl-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119936148 |
| Molecular Formula | C13H16ClF3N2OS2 |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 2-thiomorpholin-3-yl-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)Nc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C13H15F3N2OS2.ClH/c14-13(15,16)21-11-4-2-1-3-10(11)18-12(19)7-9-8-20-6-5-17-9;/h1-4,9,17H,5-8H2,(H,18,19);1H |
| InChIKey | AEQXGYPOWTYKRU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |