C13H16ClF3N2OS — CID 119706973
2-pyrrolidin-2-yl-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide;hydrochloride (PubChem CID 119706973) has the molecular formula C13H16ClF3N2OS and a molecular weight of 340.80 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-pyrrolidin-2-yl-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119706973 |
| Molecular Formula | C13H16ClF3N2OS |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-pyrrolidin-2-yl-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CCCN1)Nc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C13H15F3N2OS.ClH/c14-13(15,16)20-11-6-2-1-5-10(11)18-12(19)8-9-4-3-7-17-9;/h1-2,5-6,9,17H,3-4,7-8H2,(H,18,19);1H |
| InChIKey | NHAHEVAQCYJCHT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |