C16H19F3N2OS — CID 119706966
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide (PubChem CID 119706966) has the molecular formula C16H19F3N2OS and a molecular weight of 344.40 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 119706966 |
| Molecular Formula | C16H19F3N2OS |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(CC1CC2CCC(C1)N2)Nc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C16H19F3N2OS/c17-16(18,19)23-14-4-2-1-3-13(14)21-15(22)9-10-7-11-5-6-12(8-10)20-11/h1-4,10-12,20H,5-9H2,(H,21,22) |
| InChIKey | JMBZFKUEGWFNLK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |