C21H22ClF3N2O — CID 119813729
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(3,4,5-trifluorophenyl)phenyl]acetamide;hydrochloride (PubChem CID 119813729) has the molecular formula C21H22ClF3N2O and a molecular weight of 410.87 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(3,4,5-trifluorophenyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(3,4,5-trifluorophenyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119813729 |
| Molecular Formula | C21H22ClF3N2O |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(3,4,5-trifluorophenyl)phenyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CC2CCC(C1)N2)Nc1ccccc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C21H21F3N2O.ClH/c22-17-10-13(11-18(23)21(17)24)16-3-1-2-4-19(16)26-20(27)9-12-7-14-5-6-15(8-12)25-14;/h1-4,10-12,14-15,25H,5-9H2,(H,26,27);1H |
| InChIKey | OSRRNHYREDVCJQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|