C15H18ClF3N2O — CID 119708006
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(3,4,5-trifluorophenyl)acetamide;hydrochloride (PubChem CID 119708006) has the molecular formula C15H18ClF3N2O and a molecular weight of 334.77 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(3,4,5-trifluorophenyl)acetamide;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(3,4,5-trifluorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119708006 |
| Molecular Formula | C15H18ClF3N2O |
| Molecular Weight | 334.77 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(3,4,5-trifluorophenyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CC2CCC(C1)N2)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H17F3N2O.ClH/c16-12-6-11(7-13(17)15(12)18)20-14(21)5-8-3-9-1-2-10(4-8)19-9;/h6-10,19H,1-5H2,(H,20,21);1H |
| InChIKey | XRBSCEYMNJGXGO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|