C17H24N4O2 — CID 119702054
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(methylcarbamoylamino)phenyl]acetamide (PubChem CID 119702054) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(methylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(methylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 119702054 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(methylcarbamoylamino)phenyl]acetamide |
| SMILES | CNC(=O)Nc1cccc(NC(=O)CC2CC3CCC(C2)N3)c1 |
| InChI | InChI=1S/C17H24N4O2/c1-18-17(23)21-13-4-2-3-12(10-13)20-16(22)9-11-7-14-5-6-15(8-11)19-14/h2-4,10-11,14-15,19H,5-9H2,1H3,(H,20,22)(H2,18,21,23) |
| InChIKey | CALMADBNNMVQSZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |