C16H22ClN3O2 — CID 119687681
3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]benzamide;hydrochloride (PubChem CID 119687681) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]benzamide;hydrochloride.
| Compound Name | 3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119687681 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(NC(=O)CC2CC3CCC(C2)N3)c1 |
| InChI | InChI=1S/C16H21N3O2.ClH/c17-16(21)11-2-1-3-12(9-11)19-15(20)8-10-6-13-4-5-14(7-10)18-13;/h1-3,9-10,13-14,18H,4-8H2,(H2,17,21)(H,19,20);1H |
| InChIKey | PYAWWHNFSDJZTD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |