C16H21Cl2N3O2 — CID 119711582
5-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-2-chlorobenzamide;hydrochloride (PubChem CID 119711582) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 5-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-2-chlorobenzamide;hydrochloride.
| Compound Name | 5-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-2-chlorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119711582 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 5-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-2-chlorobenzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cc(NC(=O)CC2CC3CCC(C2)N3)ccc1Cl |
| InChI | InChI=1S/C16H20ClN3O2.ClH/c17-14-4-3-12(8-13(14)16(18)22)20-15(21)7-9-5-10-1-2-11(6-9)19-10;/h3-4,8-11,19H,1-2,5-7H2,(H2,18,22)(H,20,21);1H |
| InChIKey | WPDZPZIDKNONFH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |