C18H26ClN3O2 — CID 119735821
N-[4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]phenyl]propanamide;hydrochloride (PubChem CID 119735821) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is N-[4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]phenyl]propanamide;hydrochloride.
| Compound Name | N-[4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119735821 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]phenyl]propanamide;hydrochloride |
| SMILES | CCC(=O)Nc1ccc(NC(=O)CC2CC3CCC(C2)N3)cc1.Cl |
| InChI | InChI=1S/C18H25N3O2.ClH/c1-2-17(22)20-13-3-5-14(6-4-13)21-18(23)11-12-9-15-7-8-16(10-12)19-15;/h3-6,12,15-16,19H,2,7-11H2,1H3,(H,20,22)(H,21,23);1H |
| InChIKey | MHHIEDHELOCHBJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |