C21H31N3O2 — CID 119738252
4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-N-(2-methylbutan-2-yl)benzamide (PubChem CID 119738252) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-N-(2-methylbutan-2-yl)benzamide.
| Compound Name | 4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-N-(2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 119738252 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-N-(2-methylbutan-2-yl)benzamide |
| SMILES | CCC(C)(C)NC(=O)c1ccc(NC(=O)CC2CC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C21H31N3O2/c1-4-21(2,3)24-20(26)15-5-7-16(8-6-15)23-19(25)13-14-11-17-9-10-18(12-14)22-17/h5-8,14,17-18,22H,4,9-13H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | CBHYKXPHRVHRCC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |