C17H21F3N2O — CID 119697637
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 119697637) has the molecular formula C17H21F3N2O and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 119697637 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CC2CC3CCC(C2)N3)cc1C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O/c1-10-2-3-14(9-15(10)17(18,19)20)22-16(23)8-11-6-12-4-5-13(7-11)21-12/h2-3,9,11-13,21H,4-8H2,1H3,(H,22,23) |
| InChIKey | GQUODFWNBPPGKD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |