C17H22ClN3O2 — CID 119742671
4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-2-chloro-N-methylbenzamide (PubChem CID 119742671) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-2-chloro-N-methylbenzamide.
| Compound Name | 4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-2-chloro-N-methylbenzamide |
|---|---|
| PubChem CID | 119742671 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-2-chloro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)CC2CC3CCC(C2)N3)cc1Cl |
| InChI | InChI=1S/C17H22ClN3O2/c1-19-17(23)14-5-4-13(9-15(14)18)21-16(22)8-10-6-11-2-3-12(7-10)20-11/h4-5,9-12,20H,2-3,6-8H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | KFJVVOLJIFVJFE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |