C21H33Cl2N3O — CID 119842083
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(azepan-1-yl)phenyl]acetamide;dihydrochloride (PubChem CID 119842083) has the molecular formula C21H33Cl2N3O and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(azepan-1-yl)phenyl]acetamide;dihydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(azepan-1-yl)phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119842083 |
| Molecular Formula | C21H33Cl2N3O |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(azepan-1-yl)phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CC2CCC(C1)N2)Nc1ccccc1N1CCCCCC1 |
| InChI | InChI=1S/C21H31N3O.2ClH/c25-21(15-16-13-17-9-10-18(14-16)22-17)23-19-7-3-4-8-20(19)24-11-5-1-2-6-12-24;;/h3-4,7-8,16-18,22H,1-2,5-6,9-15H2,(H,23,25);2*1H |
| InChIKey | KWAMOQUZFBYGKO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |