C21H32N4O — CID 119901048
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]acetamide (PubChem CID 119901048) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 119901048 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)CC2CC3CCC(C2)N3)CC1 |
| InChI | InChI=1S/C21H32N4O/c1-2-24-9-11-25(12-10-24)20-6-4-3-5-19(20)23-21(26)15-16-13-17-7-8-18(14-16)22-17/h3-6,16-18,22H,2,7-15H2,1H3,(H,23,26) |
| InChIKey | VSUOOMHFKLUVOP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |