C17H31Cl3N4O — CID 119901029
N-[2-(4-ethylpiperazin-1-yl)phenyl]-4-(methylamino)butanamide;trihydrochloride (PubChem CID 119901029) has the molecular formula C17H31Cl3N4O and a molecular weight of 413.82 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)phenyl]-4-(methylamino)butanamide;trihydrochloride.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-4-(methylamino)butanamide;trihydrochloride |
|---|---|
| PubChem CID | 119901029 |
| Molecular Formula | C17H31Cl3N4O |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-4-(methylamino)butanamide;trihydrochloride |
| SMILES | CCN1CCN(c2ccccc2NC(=O)CCCNC)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C17H28N4O.3ClH/c1-3-20-11-13-21(14-12-20)16-8-5-4-7-15(16)19-17(22)9-6-10-18-2;;;/h4-5,7-8,18H,3,6,9-14H2,1-2H3,(H,19,22);3*1H |
| InChIKey | HZLQADGQZRMGRJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|