C22H28FN3O2 — CID 55973632
N-[2-(4-ethylpiperazin-1-yl)phenyl]-4-(3-fluorophenoxy)butanamide (PubChem CID 55973632) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)phenyl]-4-(3-fluorophenoxy)butanamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-4-(3-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 55973632 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-4-(3-fluorophenoxy)butanamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)CCCOc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H28FN3O2/c1-2-25-12-14-26(15-13-25)21-10-4-3-9-20(21)24-22(27)11-6-16-28-19-8-5-7-18(23)17-19/h3-5,7-10,17H,2,6,11-16H2,1H3,(H,24,27) |
| InChIKey | XZYPOBYBEMPHLF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|