C23H32N4O2 — CID 91675878
N-[5-amino-2-(4-ethylpiperazin-1-yl)phenyl]-3-butoxybenzamide (PubChem CID 91675878) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[5-amino-2-(4-ethylpiperazin-1-yl)phenyl]-3-butoxybenzamide.
| Compound Name | N-[5-amino-2-(4-ethylpiperazin-1-yl)phenyl]-3-butoxybenzamide |
|---|---|
| PubChem CID | 91675878 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | N-[5-amino-2-(4-ethylpiperazin-1-yl)phenyl]-3-butoxybenzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2cc(N)ccc2N2CCN(CC)CC2)c1 |
| InChI | InChI=1S/C23H32N4O2/c1-3-5-15-29-20-8-6-7-18(16-20)23(28)25-21-17-19(24)9-10-22(21)27-13-11-26(4-2)12-14-27/h6-10,16-17H,3-5,11-15,24H2,1-2H3,(H,25,28) |
| InChIKey | JRJTVIZEYYERNT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|