C18H23N5O — CID 91675846
N-[5-amino-2-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide (PubChem CID 91675846) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[5-amino-2-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[5-amino-2-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91675846 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[5-amino-2-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide |
| SMILES | CCN1CCN(c2ccc(N)cc2NC(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C18H23N5O/c1-2-22-8-10-23(11-9-22)17-6-5-15(19)12-16(17)21-18(24)14-4-3-7-20-13-14/h3-7,12-13H,2,8-11,19H2,1H3,(H,21,24) |
| InChIKey | YVYYFGOGZPOYAZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|