C19H22IN3O — CID 18190160
N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-iodobenzamide (PubChem CID 18190160) has the molecular formula C19H22IN3O and a molecular weight of 435.31 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-iodobenzamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 18190160 |
| Molecular Formula | C19H22IN3O |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-iodobenzamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)c2cccc(I)c2)CC1 |
| InChI | InChI=1S/C19H22IN3O/c1-2-22-10-12-23(13-11-22)18-9-4-3-8-17(18)21-19(24)15-6-5-7-16(20)14-15/h3-9,14H,2,10-13H2,1H3,(H,21,24) |
| InChIKey | FJSHUYKTLPRNBH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|