C19H22BrN3O — CID 39737929
2-bromo-N-[2-(4-ethylpiperazin-1-yl)phenyl]benzamide (PubChem CID 39737929) has the molecular formula C19H22BrN3O and a molecular weight of 388.31 g/mol. Its IUPAC name is 2-bromo-N-[2-(4-ethylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 2-bromo-N-[2-(4-ethylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 39737929 |
| Molecular Formula | C19H22BrN3O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-bromo-N-[2-(4-ethylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C19H22BrN3O/c1-2-22-11-13-23(14-12-22)18-10-6-5-9-17(18)21-19(24)15-7-3-4-8-16(15)20/h3-10H,2,11-14H2,1H3,(H,21,24) |
| InChIKey | JDQOVXBKJNWNLY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |