C22H25N3OS — CID 51237518
N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 51237518) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 51237518 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)c2sc3ccccc3c2C)CC1 |
| InChI | InChI=1S/C22H25N3OS/c1-3-24-12-14-25(15-13-24)19-10-6-5-9-18(19)23-22(26)21-16(2)17-8-4-7-11-20(17)27-21/h4-11H,3,12-15H2,1-2H3,(H,23,26) |
| InChIKey | HKPYCBHAQXTNRJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |