C16H29Cl3N4O — CID 119901069
4-amino-N-[2-(4-ethylpiperazin-1-yl)phenyl]butanamide;trihydrochloride (PubChem CID 119901069) has the molecular formula C16H29Cl3N4O and a molecular weight of 399.79 g/mol. Its IUPAC name is 4-amino-N-[2-(4-ethylpiperazin-1-yl)phenyl]butanamide;trihydrochloride.
| Compound Name | 4-amino-N-[2-(4-ethylpiperazin-1-yl)phenyl]butanamide;trihydrochloride |
|---|---|
| PubChem CID | 119901069 |
| Molecular Formula | C16H29Cl3N4O |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-amino-N-[2-(4-ethylpiperazin-1-yl)phenyl]butanamide;trihydrochloride |
| SMILES | CCN1CCN(c2ccccc2NC(=O)CCCN)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C16H26N4O.3ClH/c1-2-19-10-12-20(13-11-19)15-7-4-3-6-14(15)18-16(21)8-5-9-17;;;/h3-4,6-7H,2,5,8-13,17H2,1H3,(H,18,21);3*1H |
| InChIKey | RGDRLJRAKASWDO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |