C22H28ClN3O — CID 55757427
N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-4-phenylbutanamide (PubChem CID 55757427) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-4-phenylbutanamide.
| Compound Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 55757427 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-4-phenylbutanamide |
| SMILES | CCN1CCN(c2ccc(Cl)cc2NC(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28ClN3O/c1-2-25-13-15-26(16-14-25)21-12-11-19(23)17-20(21)24-22(27)10-6-9-18-7-4-3-5-8-18/h3-5,7-8,11-12,17H,2,6,9-10,13-16H2,1H3,(H,24,27) |
| InChIKey | ZMTYLBFKKPSNOB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |