C15H19ClF3N3OS — CID 55669090
N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 55669090) has the molecular formula C15H19ClF3N3OS and a molecular weight of 381.85 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55669090 |
| Molecular Formula | C15H19ClF3N3OS |
| Molecular Weight | 381.85 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | CCN1CCN(c2ccc(Cl)cc2NC(=O)CSC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H19ClF3N3OS/c1-2-21-5-7-22(8-6-21)13-4-3-11(16)9-12(13)20-14(23)10-24-15(17,18)19/h3-4,9H,2,5-8,10H2,1H3,(H,20,23) |
| InChIKey | SONJKJHHHOIPTR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |