C22H26ClN6OS+ — CID 4206468
N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide (PubChem CID 4206468) has the molecular formula C22H26ClN6OS+ and a molecular weight of 458.01 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide.
| Compound Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4206468 |
| Molecular Formula | C22H26ClN6OS+ |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide |
| SMILES | CCN1CCN(c2ccc(Cl)cc2NC(=O)CSc2nc[nH][n+]2-c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25ClN6OS/c1-2-27-10-12-28(13-11-27)20-9-8-17(23)14-19(20)26-21(30)15-31-22-24-16-25-29(22)18-6-4-3-5-7-18/h3-9,14,16H,2,10-13,15H2,1H3,(H,26,30)/p+1 |
| InChIKey | FDHBJUUZKVBFHK-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 68.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|