C15H23ClN4O2 — CID 110894304
1-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-(2-hydroxyethyl)urea (PubChem CID 110894304) has the molecular formula C15H23ClN4O2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 1-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110894304 |
| Molecular Formula | C15H23ClN4O2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-3-(2-hydroxyethyl)urea |
| SMILES | CCN1CCN(c2ccc(Cl)cc2NC(=O)NCCO)CC1 |
| InChI | InChI=1S/C15H23ClN4O2/c1-2-19-6-8-20(9-7-19)14-4-3-12(16)11-13(14)18-15(22)17-5-10-21/h3-4,11,21H,2,5-10H2,1H3,(H2,17,18,22) |
| InChIKey | AUHUHDJEJNJPKS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |