C21H23ClF3N3O — CID 24535040
N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 24535040) has the molecular formula C21H23ClF3N3O and a molecular weight of 425.88 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24535040 |
| Molecular Formula | C21H23ClF3N3O |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN1CCN(c2ccc(Cl)cc2NC(=O)Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H23ClF3N3O/c1-2-27-9-11-28(12-10-27)19-8-7-17(22)14-18(19)26-20(29)13-15-3-5-16(6-4-15)21(23,24)25/h3-8,14H,2,9-13H2,1H3,(H,26,29) |
| InChIKey | GBVJVZQZEIQKBL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |