C16H27Cl2N3O2 — CID 119859796
N-[2-(4-hydroxypiperidin-1-yl)phenyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119859796) has the molecular formula C16H27Cl2N3O2 and a molecular weight of 364.32 g/mol. Its IUPAC name is N-[2-(4-hydroxypiperidin-1-yl)phenyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[2-(4-hydroxypiperidin-1-yl)phenyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119859796 |
| Molecular Formula | C16H27Cl2N3O2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[2-(4-hydroxypiperidin-1-yl)phenyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)Nc1ccccc1N1CCC(O)CC1.Cl.Cl |
| InChI | InChI=1S/C16H25N3O2.2ClH/c1-17-10-4-7-16(21)18-14-5-2-3-6-15(14)19-11-8-13(20)9-12-19;;/h2-3,5-6,13,17,20H,4,7-12H2,1H3,(H,18,21);2*1H |
| InChIKey | RIJBUBQOSOHFTH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|