C12H19ClN2O — CID 119670453
4-(methylamino)-N-(2-methylphenyl)butanamide;hydrochloride (PubChem CID 119670453) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 4-(methylamino)-N-(2-methylphenyl)butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-(2-methylphenyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119670453 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-(methylamino)-N-(2-methylphenyl)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1ccccc1C.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-10-6-3-4-7-11(10)14-12(15)8-5-9-13-2;/h3-4,6-7,13H,5,8-9H2,1-2H3,(H,14,15);1H |
| InChIKey | WCDUNLAQGNKEEU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|